About pentacyclo[5.1.0.02,4.03,5.06,8]octane
pentacyclo[5.1.0.02,4.03,5.06,8]octane (PubChem CID 14087126) has the molecular formula C8H8
and a molecular weight of 104.15 g/mol. Its IUPAC name is pentacyclo[5.1.0.02,4.03,5.06,8]octane.
Molecular Properties
| Compound Name | pentacyclo[5.1.0.02,4.03,5.06,8]octane |
| PubChem CID | 14087126 |
| Molecular Formula | C8H8 |
| Molecular Weight | 104.15 g/mol |
| Exact Mass | 104.06 |
| IUPAC Name | pentacyclo[5.1.0.02,4.03,5.06,8]octane |
| SMILES | C12C3C1C1C4C1C4C23 |
| InChI | InChI=1S/C8H8/c1-2-5(1)7-3-4(7)8(3)6(1)2/h1-8H |
| InChIKey | JSPVPCAAWZVNID-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.15 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze pentacyclo[5.1.0.02,4.03,5.06,8]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentacyclo[5.1.0.02,4.03,5.06,8]octane?
The IUPAC name of pentacyclo[5.1.0.02,4.03,5.06,8]octane (CID 14087126) is pentacyclo[5.1.0.02,4.03,5.06,8]octane.
What is the SMILES notation for pentacyclo[5.1.0.02,4.03,5.06,8]octane?
The canonical SMILES for pentacyclo[5.1.0.02,4.03,5.06,8]octane is C12C3C1C1C4C1C4C23.
What is the InChIKey of pentacyclo[5.1.0.02,4.03,5.06,8]octane?
The InChIKey is JSPVPCAAWZVNID-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8/c1-2-5(1)7-3-4(7)8(3)6(1)2/h1-8H.
What are the key properties of pentacyclo[5.1.0.02,4.03,5.06,8]octane?
pentacyclo[5.1.0.02,4.03,5.06,8]octane has a molecular weight of 104.15 g/mol, XLogP of 0.98, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for pentacyclo[5.1.0.02,4.03,5.06,8]octane is sourced from PubChem (CID 14087126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).