About pentacyclo[5.1.0.02,4.03,5.06,8]octane-3-carbonitrile
pentacyclo[5.1.0.02,4.03,5.06,8]octane-3-carbonitrile (PubChem CID 14087127) has the molecular formula C9H7N
and a molecular weight of 129.16 g/mol. Its IUPAC name is pentacyclo[5.1.0.02,4.03,5.06,8]octane-3-carbonitrile.
Molecular Properties
| Compound Name | pentacyclo[5.1.0.02,4.03,5.06,8]octane-3-carbonitrile |
| PubChem CID | 14087127 |
| Molecular Formula | C9H7N |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | pentacyclo[5.1.0.02,4.03,5.06,8]octane-3-carbonitrile |
| SMILES | N#CC12C3C4C5C4C5C1C32 |
| InChI | InChI=1S/C9H7N/c10-1-9-6-4-2-3(4)5(2)7(9)8(6)9/h2-8H |
| InChIKey | GCKYWZWTENWVDW-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze pentacyclo[5.1.0.02,4.03,5.06,8]octane-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentacyclo[5.1.0.02,4.03,5.06,8]octane-3-carbonitrile?
The IUPAC name of pentacyclo[5.1.0.02,4.03,5.06,8]octane-3-carbonitrile (CID 14087127) is pentacyclo[5.1.0.02,4.03,5.06,8]octane-3-carbonitrile.
What is the SMILES notation for pentacyclo[5.1.0.02,4.03,5.06,8]octane-3-carbonitrile?
The canonical SMILES for pentacyclo[5.1.0.02,4.03,5.06,8]octane-3-carbonitrile is N#CC12C3C4C5C4C5C1C32.
What is the InChIKey of pentacyclo[5.1.0.02,4.03,5.06,8]octane-3-carbonitrile?
The InChIKey is GCKYWZWTENWVDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N/c10-1-9-6-4-2-3(4)5(2)7(9)8(6)9/h2-8H.
What are the key properties of pentacyclo[5.1.0.02,4.03,5.06,8]octane-3-carbonitrile?
pentacyclo[5.1.0.02,4.03,5.06,8]octane-3-carbonitrile has a molecular weight of 129.16 g/mol, XLogP of 0.88, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentacyclo[5.1.0.02,4.03,5.06,8]octane-3-carbonitrile is sourced from PubChem (CID 14087127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).