About 6-[2-(2,3-dimethylphenyl)ethenyl]-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile
6-[2-(2,3-dimethylphenyl)ethenyl]-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile (PubChem CID 140871581) has the molecular formula C15H13N3OS
and a molecular weight of 283.36 g/mol. Its IUPAC name is 6-[2-(2,3-dimethylphenyl)ethenyl]-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 6-[2-(2,3-dimethylphenyl)ethenyl]-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile |
| PubChem CID | 140871581 |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 6-[2-(2,3-dimethylphenyl)ethenyl]-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile |
| SMILES | Cc1cccc(C=Cc2[nH]c(=S)[nH]c(=O)c2C#N)c1C |
| InChI | InChI=1S/C15H13N3OS/c1-9-4-3-5-11(10(9)2)6-7-13-12(8-16)14(19)18-15(20)17-13/h3-7H,1-2H3,(H2,17,18,19,20) |
| InChIKey | WNHFGNZJVWWRBE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-(2,3-dimethylphenyl)ethenyl]-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(2,3-dimethylphenyl)ethenyl]-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile?
The IUPAC name of 6-[2-(2,3-dimethylphenyl)ethenyl]-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile (CID 140871581) is 6-[2-(2,3-dimethylphenyl)ethenyl]-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile.
What is the SMILES notation for 6-[2-(2,3-dimethylphenyl)ethenyl]-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile?
The canonical SMILES for 6-[2-(2,3-dimethylphenyl)ethenyl]-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile is Cc1cccc(C=Cc2[nH]c(=S)[nH]c(=O)c2C#N)c1C.
What is the InChIKey of 6-[2-(2,3-dimethylphenyl)ethenyl]-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile?
The InChIKey is WNHFGNZJVWWRBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3OS/c1-9-4-3-5-11(10(9)2)6-7-13-12(8-16)14(19)18-15(20)17-13/h3-7H,1-2H3,(H2,17,18,19,20).
What are the key properties of 6-[2-(2,3-dimethylphenyl)ethenyl]-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile?
6-[2-(2,3-dimethylphenyl)ethenyl]-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile has a molecular weight of 283.36 g/mol, XLogP of 3.09, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(2,3-dimethylphenyl)ethenyl]-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile is sourced from PubChem (CID 140871581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).