C38H23N7 — CID 140871952
3-[3-(3-cyanophenyl)-6-(3-isocyanophenyl)carbazol-9-yl]-4-(4,6-dimethyl-1,3,5-triazin-2-yl)benzonitrile (PubChem CID 140871952) has the molecular formula C38H23N7 and a molecular weight of 577.65 g/mol. Its IUPAC name is 3-[3-(3-cyanophenyl)-6-(3-isocyanophenyl)carbazol-9-yl]-4-(4,6-dimethyl-1,3,5-triazin-2-yl)benzonitrile.
| Compound Name | 3-[3-(3-cyanophenyl)-6-(3-isocyanophenyl)carbazol-9-yl]-4-(4,6-dimethyl-1,3,5-triazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 140871952 |
| Molecular Formula | C38H23N7 |
| Molecular Weight | 577.65 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | 3-[3-(3-cyanophenyl)-6-(3-isocyanophenyl)carbazol-9-yl]-4-(4,6-dimethyl-1,3,5-triazin-2-yl)benzonitrile |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c(c2)c2cc(-c4cccc(C#N)c4)ccc2n3-c2cc(C#N)ccc2-c2nc(C)nc(C)n2)c1 |
| InChI | InChI=1S/C38H23N7/c1-23-42-24(2)44-38(43-23)32-13-10-26(22-40)17-37(32)45-35-14-11-29(27-7-4-6-25(16-27)21-39)19-33(35)34-20-30(12-15-36(34)45)28-8-5-9-31(18-28)41-3/h4-20H,1-2H3 |
| InChIKey | BMGHXHVJDVTRCW-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 95.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.65 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|