About CID 140872014
CID 140872014 (PubChem CID 140872014) has the molecular formula C16H11BrSi
and a molecular weight of 311.25 g/mol.
Molecular Properties
| Compound Name | CID 140872014 |
| PubChem CID | 140872014 |
| Molecular Formula | C16H11BrSi |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | — |
| SMILES | Brc1cccc2c([Si]c3ccccc3)cccc12 |
| InChI | InChI=1S/C16H11BrSi/c17-15-10-4-9-14-13(15)8-5-11-16(14)18-12-6-2-1-3-7-12/h1-11H |
| InChIKey | PDLSVOKPZBTTJC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 140872014 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140872014?
The IUPAC name of CID 140872014 (CID 140872014) is not available.
What is the SMILES notation for CID 140872014?
The canonical SMILES for CID 140872014 is Brc1cccc2c([Si]c3ccccc3)cccc12.
What is the InChIKey of CID 140872014?
The InChIKey is PDLSVOKPZBTTJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11BrSi/c17-15-10-4-9-14-13(15)8-5-11-16(14)18-12-6-2-1-3-7-12/h1-11H.
What are the key properties of CID 140872014?
CID 140872014 has a molecular weight of 311.25 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140872014 is sourced from PubChem (CID 140872014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).