C15H23BN4O4 — CID 140872345
[6-[4-[(3S)-3-methoxypyrrolidine-1-carbonyl]piperazin-1-yl]-3-pyridinyl]boronic acid (PubChem CID 140872345) has the molecular formula C15H23BN4O4 and a molecular weight of 334.19 g/mol. Its IUPAC name is [6-[4-[(3S)-3-methoxypyrrolidine-1-carbonyl]piperazin-1-yl]-3-pyridinyl]boronic acid.
| Compound Name | [6-[4-[(3S)-3-methoxypyrrolidine-1-carbonyl]piperazin-1-yl]-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 140872345 |
| Molecular Formula | C15H23BN4O4 |
| Molecular Weight | 334.19 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | [6-[4-[(3S)-3-methoxypyrrolidine-1-carbonyl]piperazin-1-yl]-3-pyridinyl]boronic acid |
| SMILES | CO[C@H]1CCN(C(=O)N2CCN(c3ccc(B(O)O)cn3)CC2)C1 |
| InChI | InChI=1S/C15H23BN4O4/c1-24-13-4-5-20(11-13)15(21)19-8-6-18(7-9-19)14-3-2-12(10-17-14)16(22)23/h2-3,10,13,22-23H,4-9,11H2,1H3/t13-/m0/s1 |
| InChIKey | QANRHQMZBFSZFK-ZDUSSCGKSA-N |
| XLogP | -1.28 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.19 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|