C23H30BFN4O5 — CID 140872354
tert-butyl 3-[[3-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridin-6-yl]oxymethyl]-3-fluoroazetidine-1-carboxylate (PubChem CID 140872354) has the molecular formula C23H30BFN4O5 and a molecular weight of 472.33 g/mol. Its IUPAC name is tert-butyl 3-[[3-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridin-6-yl]oxymethyl]-3-fluoroazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[3-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridin-6-yl]oxymethyl]-3-fluoroazetidine-1-carboxylate |
|---|---|
| PubChem CID | 140872354 |
| Molecular Formula | C23H30BFN4O5 |
| Molecular Weight | 472.33 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | tert-butyl 3-[[3-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridin-6-yl]oxymethyl]-3-fluoroazetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(F)(COc2cc(B3OC(C)(C)C(C)(C)O3)c3c(C#N)cnn3c2)C1 |
| InChI | InChI=1S/C23H30BFN4O5/c1-20(2,3)32-19(30)28-12-23(25,13-28)14-31-16-8-17(18-15(9-26)10-27-29(18)11-16)24-33-21(4,5)22(6,7)34-24/h8,10-11H,12-14H2,1-7H3 |
| InChIKey | QGBUOJUYZDXBFP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 98.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|