C18H24BN3O4 — CID 140872390
6-(2-hydroxy-2-methylpropoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 140872390) has the molecular formula C18H24BN3O4 and a molecular weight of 357.22 g/mol. Its IUPAC name is 6-(2-hydroxy-2-methylpropoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridine-3-carbonitrile.
| Compound Name | 6-(2-hydroxy-2-methylpropoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 140872390 |
| Molecular Formula | C18H24BN3O4 |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 6-(2-hydroxy-2-methylpropoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | CC(C)(O)COc1cc(B2OC(C)(C)C(C)(C)O2)c2c(C#N)cnn2c1 |
| InChI | InChI=1S/C18H24BN3O4/c1-16(2,23)11-24-13-7-14(15-12(8-20)9-21-22(15)10-13)19-25-17(3,4)18(5,6)26-19/h7,9-10,23H,11H2,1-6H3 |
| InChIKey | ZCWVJJKHYGGNDK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|