C10H15Si — CID 14087342
1,2,3,4,5-Pentamethylcyclopentadienylsilane (PubChem CID 14087342) has the molecular formula C10H15Si and a molecular weight of 163.32 g/mol.
| Compound Name | 1,2,3,4,5-Pentamethylcyclopentadienylsilane |
|---|---|
| PubChem CID | 14087342 |
| Molecular Formula | C10H15Si |
| Molecular Weight | 163.32 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | — |
| SMILES | CC1=C(C)C(C)([Si])C(C)=C1C |
| InChI | InChI=1S/C10H15Si/c1-6-7(2)9(4)10(5,11)8(6)3/h1-5H3 |
| InChIKey | HFOCESJMQSMMLU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|