C16H23N6O2+ — CID 140873456
7-[4-(3-methyl-1,2-oxazol-5-yl)butyl]-1-(2-methylpropyl)-[1,2,4]triazolo[3,4-f][1,2,4]triazin-1-ium-8-one (PubChem CID 140873456) has the molecular formula C16H23N6O2+ and a molecular weight of 331.40 g/mol. Its IUPAC name is 7-[4-(3-methyl-1,2-oxazol-5-yl)butyl]-1-(2-methylpropyl)-[1,2,4]triazolo[3,4-f][1,2,4]triazin-1-ium-8-one.
| Compound Name | 7-[4-(3-methyl-1,2-oxazol-5-yl)butyl]-1-(2-methylpropyl)-[1,2,4]triazolo[3,4-f][1,2,4]triazin-1-ium-8-one |
|---|---|
| PubChem CID | 140873456 |
| Molecular Formula | C16H23N6O2+ |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 7-[4-(3-methyl-1,2-oxazol-5-yl)butyl]-1-(2-methylpropyl)-[1,2,4]triazolo[3,4-f][1,2,4]triazin-1-ium-8-one |
| SMILES | Cc1cc(CCCCn2cnn3cn[n+](CC(C)C)c3c2=O)on1 |
| InChI | InChI=1S/C16H23N6O2/c1-12(2)9-21-15-16(23)20(10-17-22(15)11-18-21)7-5-4-6-14-8-13(3)19-24-14/h8,10-12H,4-7,9H2,1-3H3/q+1 |
| InChIKey | OFIFWHAPKLJOIT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 82.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|