About Decamethylsilicocene
Decamethylsilicocene (PubChem CID 14087351) has the molecular formula C20H30Si
and a molecular weight of 298.55 g/mol.
Molecular Properties
| Compound Name | Decamethylsilicocene |
| PubChem CID | 14087351 |
| Molecular Formula | C20H30Si |
| Molecular Weight | 298.55 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | — |
| SMILES | CC1=C(C)C(C)([Si]C2(C)C(C)=C(C)C(C)=C2C)C(C)=C1C |
| InChI | InChI=1S/C20H30Si/c1-11-12(2)16(6)19(9,15(11)5)21-20(10)17(7)13(3)14(4)18(20)8/h1-10H3 |
| InChIKey | LLBUUNANYHWUKK-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.55 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Decamethylsilicocene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Decamethylsilicocene?
The IUPAC name of Decamethylsilicocene (CID 14087351) is not available.
What is the SMILES notation for Decamethylsilicocene?
The canonical SMILES for Decamethylsilicocene is CC1=C(C)C(C)([Si]C2(C)C(C)=C(C)C(C)=C2C)C(C)=C1C.
What is the InChIKey of Decamethylsilicocene?
The InChIKey is LLBUUNANYHWUKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30Si/c1-11-12(2)16(6)19(9,15(11)5)21-20(10)17(7)13(3)14(4)18(20)8/h1-10H3.
What are the key properties of Decamethylsilicocene?
Decamethylsilicocene has a molecular weight of 298.55 g/mol, XLogP of 6.42, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Decamethylsilicocene is sourced from PubChem (CID 14087351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).