C28H39B2F3N2O5 — CID 140874194
1-(oxan-2-yl)-5-[(Z)-4,4,4-trifluoro-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]indazole (PubChem CID 140874194) has the molecular formula C28H39B2F3N2O5 and a molecular weight of 562.25 g/mol. Its IUPAC name is 1-(oxan-2-yl)-5-[(Z)-4,4,4-trifluoro-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]indazole.
| Compound Name | 1-(oxan-2-yl)-5-[(Z)-4,4,4-trifluoro-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]indazole |
|---|---|
| PubChem CID | 140874194 |
| Molecular Formula | C28H39B2F3N2O5 |
| Molecular Weight | 562.25 g/mol |
| Exact Mass | 562.30 |
| IUPAC Name | 1-(oxan-2-yl)-5-[(Z)-4,4,4-trifluoro-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]indazole |
| SMILES | CC1(C)OB(/C(CC(F)(F)F)=C(\B2OC(C)(C)C(C)(C)O2)c2ccc3c(cnn3C3CCCCO3)c2)OC1(C)C |
| InChI | InChI=1S/C28H39B2F3N2O5/c1-24(2)25(3,4)38-29(37-24)20(16-28(31,32)33)23(30-39-26(5,6)27(7,8)40-30)18-12-13-21-19(15-18)17-34-35(21)22-11-9-10-14-36-22/h12-13,15,17,22H,9-11,14,16H2,1-8H3/b23-20- |
| InChIKey | BAVGUSSYMFBGEH-ATJXCDBQSA-N |
| XLogP | 6.70 |
| TPSA | 63.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.25 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|