About CID 140875355
CID 140875355 (PubChem CID 140875355) has the molecular formula C36H40N
and a molecular weight of 486.72 g/mol.
Molecular Properties
| Compound Name | CID 140875355 |
| PubChem CID | 140875355 |
| Molecular Formula | C36H40N |
| Molecular Weight | 486.72 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c([C]2c3ccc(C(C)(C)C)cc3N(c3ccccc3)c3cc(C(C)(C)C)ccc32)c(C)c1 |
| InChI | InChI=1S/C36H40N/c1-23-19-24(2)33(25(3)20-23)34-29-17-15-26(35(4,5)6)21-31(29)37(28-13-11-10-12-14-28)32-22-27(36(7,8)9)16-18-30(32)34/h10-22H,1-9H3 |
| InChIKey | XJXGKOMQVHNLAK-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.72 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 140875355 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140875355?
The IUPAC name of CID 140875355 (CID 140875355) is not available.
What is the SMILES notation for CID 140875355?
The canonical SMILES for CID 140875355 is Cc1cc(C)c([C]2c3ccc(C(C)(C)C)cc3N(c3ccccc3)c3cc(C(C)(C)C)ccc32)c(C)c1.
What is the InChIKey of CID 140875355?
The InChIKey is XJXGKOMQVHNLAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H40N/c1-23-19-24(2)33(25(3)20-23)34-29-17-15-26(35(4,5)6)21-31(29)37(28-13-11-10-12-14-28)32-22-27(36(7,8)9)16-18-30(32)34/h10-22H,1-9H3.
What are the key properties of CID 140875355?
CID 140875355 has a molecular weight of 486.72 g/mol, XLogP of 10.01, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140875355 is sourced from PubChem (CID 140875355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).