C28H42N6O6SSi — CID 140875643
(1R,2S)-1-[tert-butyl(dimethyl)silyl]oxy-N-[4-(2,6-dimethoxyphenyl)-5-[(3S)-oxolan-3-yl]-1,2,4-triazol-3-yl]-1-(5-methylpyrimidin-2-yl)propane-2-sulfonamide (PubChem CID 140875643) has the molecular formula C28H42N6O6SSi and a molecular weight of 618.83 g/mol. Its IUPAC name is (1R,2S)-1-[tert-butyl(dimethyl)silyl]oxy-N-[4-(2,6-dimethoxyphenyl)-5-[(3S)-oxolan-3-yl]-1,2,4-triazol-3-yl]-1-(5-methylpyrimidin-2-yl)propane-2-sulfonamide.
| Compound Name | (1R,2S)-1-[tert-butyl(dimethyl)silyl]oxy-N-[4-(2,6-dimethoxyphenyl)-5-[(3S)-oxolan-3-yl]-1,2,4-triazol-3-yl]-1-(5-methylpyrimidin-2-yl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 140875643 |
| Molecular Formula | C28H42N6O6SSi |
| Molecular Weight | 618.83 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | (1R,2S)-1-[tert-butyl(dimethyl)silyl]oxy-N-[4-(2,6-dimethoxyphenyl)-5-[(3S)-oxolan-3-yl]-1,2,4-triazol-3-yl]-1-(5-methylpyrimidin-2-yl)propane-2-sulfonamide |
| SMILES | COc1cccc(OC)c1-n1c(NS(=O)(=O)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)c2ncc(C)cn2)nnc1[C@@H]1CCOC1 |
| InChI | InChI=1S/C28H42N6O6SSi/c1-18-15-29-25(30-16-18)24(40-42(8,9)28(3,4)5)19(2)41(35,36)33-27-32-31-26(20-13-14-39-17-20)34(27)23-21(37-6)11-10-12-22(23)38-7/h10-12,15-16,19-20,24H,13-14,17H2,1-9H3,(H,32,33)/t19-,20+,24-/m0/s1 |
| InChIKey | DGVAGRAJXPWDSS-ROKPMTFOSA-N |
| XLogP | 4.78 |
| TPSA | 139.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.83 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|