C17H34N2 — CID 140875897
4-(3-cyclohexylpentan-3-yl)cyclohexane-1,1-diamine (PubChem CID 140875897) has the molecular formula C17H34N2 and a molecular weight of 266.47 g/mol. Its IUPAC name is 4-(3-cyclohexylpentan-3-yl)cyclohexane-1,1-diamine.
| Compound Name | 4-(3-cyclohexylpentan-3-yl)cyclohexane-1,1-diamine |
|---|---|
| PubChem CID | 140875897 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | 4-(3-cyclohexylpentan-3-yl)cyclohexane-1,1-diamine |
| SMILES | CCC(CC)(C1CCCCC1)C1CCC(N)(N)CC1 |
| InChI | InChI=1S/C17H34N2/c1-3-16(4-2,14-8-6-5-7-9-14)15-10-12-17(18,19)13-11-15/h14-15H,3-13,18-19H2,1-2H3 |
| InChIKey | XOQOGJBALIPRRF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|