About 2-(3,5-diisocyanophenyl)-4,8-diphenylthieno[2,3-f][1]benzothiole
2-(3,5-diisocyanophenyl)-4,8-diphenylthieno[2,3-f][1]benzothiole (PubChem CID 140876335) has the molecular formula C30H16N2S2
and a molecular weight of 468.61 g/mol. Its IUPAC name is 2-(3,5-diisocyanophenyl)-4,8-diphenylthieno[2,3-f][1]benzothiole.
Molecular Properties
| Compound Name | 2-(3,5-diisocyanophenyl)-4,8-diphenylthieno[2,3-f][1]benzothiole |
| PubChem CID | 140876335 |
| Molecular Formula | C30H16N2S2 |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 2-(3,5-diisocyanophenyl)-4,8-diphenylthieno[2,3-f][1]benzothiole |
| SMILES | [C-]#[N+]c1cc([N+]#[C-])cc(-c2cc3c(-c4ccccc4)c4sccc4c(-c4ccccc4)c3s2)c1 |
| InChI | InChI=1S/C30H16N2S2/c1-31-22-15-21(16-23(17-22)32-2)26-18-25-28(20-11-7-4-8-12-20)29-24(13-14-33-29)27(30(25)34-26)19-9-5-3-6-10-19/h3-18H |
| InChIKey | PWJHMRCEZQUINX-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 8.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-diisocyanophenyl)-4,8-diphenylthieno[2,3-f][1]benzothiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-diisocyanophenyl)-4,8-diphenylthieno[2,3-f][1]benzothiole?
The IUPAC name of 2-(3,5-diisocyanophenyl)-4,8-diphenylthieno[2,3-f][1]benzothiole (CID 140876335) is 2-(3,5-diisocyanophenyl)-4,8-diphenylthieno[2,3-f][1]benzothiole.
What is the SMILES notation for 2-(3,5-diisocyanophenyl)-4,8-diphenylthieno[2,3-f][1]benzothiole?
The canonical SMILES for 2-(3,5-diisocyanophenyl)-4,8-diphenylthieno[2,3-f][1]benzothiole is [C-]#[N+]c1cc([N+]#[C-])cc(-c2cc3c(-c4ccccc4)c4sccc4c(-c4ccccc4)c3s2)c1.
What is the InChIKey of 2-(3,5-diisocyanophenyl)-4,8-diphenylthieno[2,3-f][1]benzothiole?
The InChIKey is PWJHMRCEZQUINX-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H16N2S2/c1-31-22-15-21(16-23(17-22)32-2)26-18-25-28(20-11-7-4-8-12-20)29-24(13-14-33-29)27(30(25)34-26)19-9-5-3-6-10-19/h3-18H.
What are the key properties of 2-(3,5-diisocyanophenyl)-4,8-diphenylthieno[2,3-f][1]benzothiole?
2-(3,5-diisocyanophenyl)-4,8-diphenylthieno[2,3-f][1]benzothiole has a molecular weight of 468.61 g/mol, XLogP of 10.22, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-diisocyanophenyl)-4,8-diphenylthieno[2,3-f][1]benzothiole is sourced from PubChem (CID 140876335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).