C30H32N4O4 — CID 140876455
1-[4-[3-(cyclopropylcarbamoyl)phenyl]phenyl]-5,5-dimethoxy-N,4-dimethyl-4H-2,3-benzodiazepine-3-carboxamide (PubChem CID 140876455) has the molecular formula C30H32N4O4 and a molecular weight of 512.61 g/mol. Its IUPAC name is 1-[4-[3-(cyclopropylcarbamoyl)phenyl]phenyl]-5,5-dimethoxy-N,4-dimethyl-4H-2,3-benzodiazepine-3-carboxamide.
| Compound Name | 1-[4-[3-(cyclopropylcarbamoyl)phenyl]phenyl]-5,5-dimethoxy-N,4-dimethyl-4H-2,3-benzodiazepine-3-carboxamide |
|---|---|
| PubChem CID | 140876455 |
| Molecular Formula | C30H32N4O4 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | 1-[4-[3-(cyclopropylcarbamoyl)phenyl]phenyl]-5,5-dimethoxy-N,4-dimethyl-4H-2,3-benzodiazepine-3-carboxamide |
| SMILES | CNC(=O)N1N=C(c2ccc(-c3cccc(C(=O)NC4CC4)c3)cc2)c2ccccc2C(OC)(OC)C1C |
| InChI | InChI=1S/C30H32N4O4/c1-19-30(37-3,38-4)26-11-6-5-10-25(26)27(33-34(19)29(36)31-2)21-14-12-20(13-15-21)22-8-7-9-23(18-22)28(35)32-24-16-17-24/h5-15,18-19,24H,16-17H2,1-4H3,(H,31,36)(H,32,35) |
| InChIKey | LEZAKZYGONBICM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|