C46H39BN2O2 — CID 140877006
7,14-dimethyl-6,13-diphenyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinolino[4,3-j]phenanthridine (PubChem CID 140877006) has the molecular formula C46H39BN2O2 and a molecular weight of 662.64 g/mol. Its IUPAC name is 7,14-dimethyl-6,13-diphenyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinolino[4,3-j]phenanthridine.
| Compound Name | 7,14-dimethyl-6,13-diphenyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinolino[4,3-j]phenanthridine |
|---|---|
| PubChem CID | 140877006 |
| Molecular Formula | C46H39BN2O2 |
| Molecular Weight | 662.64 g/mol |
| Exact Mass | 662.31 |
| IUPAC Name | 7,14-dimethyl-6,13-diphenyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinolino[4,3-j]phenanthridine |
| SMILES | Cc1c2c(-c3ccccc3)nc3cc(-c4cccc(B5OC(C)(C)C(C)(C)O5)c4)ccc3c2c(C)c2c(-c3ccccc3)nc3ccccc3c12 |
| InChI | InChI=1S/C46H39BN2O2/c1-28-39-35-22-13-14-23-37(35)48-43(30-16-9-7-10-17-30)41(39)29(2)40-36-25-24-33(27-38(36)49-44(42(28)40)31-18-11-8-12-19-31)32-20-15-21-34(26-32)47-50-45(3,4)46(5,6)51-47/h7-27H,1-6H3 |
| InChIKey | MTXXYVXIJNOKHH-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.64 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|