C40H35BN2O2 — CID 140877009
7,14-dimethyl-6,13-diphenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolino[4,3-j]phenanthridine (PubChem CID 140877009) has the molecular formula C40H35BN2O2 and a molecular weight of 586.54 g/mol. Its IUPAC name is 7,14-dimethyl-6,13-diphenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolino[4,3-j]phenanthridine.
| Compound Name | 7,14-dimethyl-6,13-diphenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolino[4,3-j]phenanthridine |
|---|---|
| PubChem CID | 140877009 |
| Molecular Formula | C40H35BN2O2 |
| Molecular Weight | 586.54 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | 7,14-dimethyl-6,13-diphenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolino[4,3-j]phenanthridine |
| SMILES | Cc1c2c(-c3ccccc3)nc3cc(B4OC(C)(C)C(C)(C)O4)ccc3c2c(C)c2c(-c3ccccc3)nc3ccccc3c12 |
| InChI | InChI=1S/C40H35BN2O2/c1-24-33-29-19-13-14-20-31(29)42-37(26-15-9-7-10-16-26)35(33)25(2)34-30-22-21-28(41-44-39(3,4)40(5,6)45-41)23-32(30)43-38(36(24)34)27-17-11-8-12-18-27/h7-23H,1-6H3 |
| InChIKey | QRBZAWPJVGHFLQ-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.54 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|