C24H38FN5O4Si2 — CID 140877194
1-[(1S,2S,4R,6R,8R)-2-[tert-butyl(dimethyl)silyl]oxy-4-fluoro-6-trimethylsilyloxy-9-oxatricyclo[4.3.0.02,4]nonan-8-yl]-5-methyl-4-(1,2,4-triazol-1-yl)pyrimidin-2-one (PubChem CID 140877194) has the molecular formula C24H38FN5O4Si2 and a molecular weight of 535.77 g/mol. Its IUPAC name is 1-[(1S,2S,4R,6R,8R)-2-[tert-butyl(dimethyl)silyl]oxy-4-fluoro-6-trimethylsilyloxy-9-oxatricyclo[4.3.0.02,4]nonan-8-yl]-5-methyl-4-(1,2,4-triazol-1-yl)pyrimidin-2-one.
| Compound Name | 1-[(1S,2S,4R,6R,8R)-2-[tert-butyl(dimethyl)silyl]oxy-4-fluoro-6-trimethylsilyloxy-9-oxatricyclo[4.3.0.02,4]nonan-8-yl]-5-methyl-4-(1,2,4-triazol-1-yl)pyrimidin-2-one |
|---|---|
| PubChem CID | 140877194 |
| Molecular Formula | C24H38FN5O4Si2 |
| Molecular Weight | 535.77 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | 1-[(1S,2S,4R,6R,8R)-2-[tert-butyl(dimethyl)silyl]oxy-4-fluoro-6-trimethylsilyloxy-9-oxatricyclo[4.3.0.02,4]nonan-8-yl]-5-methyl-4-(1,2,4-triazol-1-yl)pyrimidin-2-one |
| SMILES | Cc1cn([C@H]2C[C@@]3(O[Si](C)(C)C)C[C@]4(F)C[C@]4(O[Si](C)(C)C(C)(C)C)[C@H]3O2)c(=O)nc1-n1cncn1 |
| InChI | InChI=1S/C24H38FN5O4Si2/c1-16-11-29(20(31)28-18(16)30-15-26-14-27-30)17-10-22(33-35(5,6)7)12-23(25)13-24(23,19(22)32-17)34-36(8,9)21(2,3)4/h11,14-15,17,19H,10,12-13H2,1-9H3/t17-,19+,22-,23+,24+/m1/s1 |
| InChIKey | WQMZBXPEEKDMAY-OTBWLPETSA-N |
| XLogP | 4.29 |
| TPSA | 93.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.77 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|