C16H30N2O2Si — CID 140879240
(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-1-pyridin-2-ylbutan-2-amine (PubChem CID 140879240) has the molecular formula C16H30N2O2Si and a molecular weight of 310.51 g/mol. Its IUPAC name is (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-1-pyridin-2-ylbutan-2-amine.
| Compound Name | (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-1-pyridin-2-ylbutan-2-amine |
|---|---|
| PubChem CID | 140879240 |
| Molecular Formula | C16H30N2O2Si |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-1-pyridin-2-ylbutan-2-amine |
| SMILES | COC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)Cc1ccccn1 |
| InChI | InChI=1S/C16H30N2O2Si/c1-16(2,3)21(5,6)20-15(12-19-4)14(17)11-13-9-7-8-10-18-13/h7-10,14-15H,11-12,17H2,1-6H3/t14-,15-/m1/s1 |
| InChIKey | ZSCAKGFBSBRTQV-HUUCEWRRSA-N |
| XLogP | 2.99 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|