C31H36ClFN4O2Si — CID 140879261
N-[(2R)-4-[tert-butyl(dimethyl)silyl]oxy-1-pyridin-2-ylbutan-2-yl]-3-chloro-2-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]benzamide (PubChem CID 140879261) has the molecular formula C31H36ClFN4O2Si and a molecular weight of 579.19 g/mol. Its IUPAC name is N-[(2R)-4-[tert-butyl(dimethyl)silyl]oxy-1-pyridin-2-ylbutan-2-yl]-3-chloro-2-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]benzamide.
| Compound Name | N-[(2R)-4-[tert-butyl(dimethyl)silyl]oxy-1-pyridin-2-ylbutan-2-yl]-3-chloro-2-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]benzamide |
|---|---|
| PubChem CID | 140879261 |
| Molecular Formula | C31H36ClFN4O2Si |
| Molecular Weight | 579.19 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | N-[(2R)-4-[tert-butyl(dimethyl)silyl]oxy-1-pyridin-2-ylbutan-2-yl]-3-chloro-2-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]benzamide |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H](Cc1ccccn1)NC(=O)c1cccc(Cl)c1-c1cc(-c2ccc(F)cc2)n[nH]1 |
| InChI | InChI=1S/C31H36ClFN4O2Si/c1-31(2,3)40(4,5)39-18-16-24(19-23-9-6-7-17-34-23)35-30(38)25-10-8-11-26(32)29(25)28-20-27(36-37-28)21-12-14-22(33)15-13-21/h6-15,17,20,24H,16,18-19H2,1-5H3,(H,35,38)(H,36,37)/t24-/m0/s1 |
| InChIKey | FRMHUQBNWRJJRH-DEOSSOPVSA-N |
| XLogP | 7.68 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.19 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|