C13H24INO4 — CID 140879292
tert-butyl (4S,5S)-4-(iodomethyl)-5-(methoxymethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 140879292) has the molecular formula C13H24INO4 and a molecular weight of 385.24 g/mol. Its IUPAC name is tert-butyl (4S,5S)-4-(iodomethyl)-5-(methoxymethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5S)-4-(iodomethyl)-5-(methoxymethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 140879292 |
| Molecular Formula | C13H24INO4 |
| Molecular Weight | 385.24 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | tert-butyl (4S,5S)-4-(iodomethyl)-5-(methoxymethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | COC[C@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@@H]1CI |
| InChI | InChI=1S/C13H24INO4/c1-12(2,3)19-11(16)15-9(7-14)10(8-17-6)18-13(15,4)5/h9-10H,7-8H2,1-6H3/t9-,10-/m1/s1 |
| InChIKey | GTSWRNMCHKQUKF-NXEZZACHSA-N |
| XLogP | 2.81 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|