C16H11ClF3N5O2 — CID 140879731
15-chloro-9-(2,2,2-trifluoroethoxymethyl)-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene-5-carbaldehyde (PubChem CID 140879731) has the molecular formula C16H11ClF3N5O2 and a molecular weight of 397.74 g/mol. Its IUPAC name is 15-chloro-9-(2,2,2-trifluoroethoxymethyl)-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene-5-carbaldehyde.
| Compound Name | 15-chloro-9-(2,2,2-trifluoroethoxymethyl)-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene-5-carbaldehyde |
|---|---|
| PubChem CID | 140879731 |
| Molecular Formula | C16H11ClF3N5O2 |
| Molecular Weight | 397.74 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 15-chloro-9-(2,2,2-trifluoroethoxymethyl)-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene-5-carbaldehyde |
| SMILES | O=Cc1ncn2c1Cn1c(COCC(F)(F)F)nnc1-c1cc(Cl)ccc1-2 |
| InChI | InChI=1S/C16H11ClF3N5O2/c17-9-1-2-12-10(3-9)15-23-22-14(6-27-7-16(18,19)20)24(15)4-13-11(5-26)21-8-25(12)13/h1-3,5,8H,4,6-7H2 |
| InChIKey | OPKGBBPAEHFRHN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.74 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|