C23H25ClN2O5 — CID 140879827
6-tert-butyl-10-chloro-1-isocyano-9-(3-methoxypropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid (PubChem CID 140879827) has the molecular formula C23H25ClN2O5 and a molecular weight of 444.92 g/mol. Its IUPAC name is 6-tert-butyl-10-chloro-1-isocyano-9-(3-methoxypropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid.
| Compound Name | 6-tert-butyl-10-chloro-1-isocyano-9-(3-methoxypropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid |
|---|---|
| PubChem CID | 140879827 |
| Molecular Formula | C23H25ClN2O5 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 6-tert-butyl-10-chloro-1-isocyano-9-(3-methoxypropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid |
| SMILES | [C-]#[N+]c1c2n(cc(C(=O)O)c1=O)C(C(C)(C)C)Cc1cc(OCCCOC)c(Cl)cc1-2 |
| InChI | InChI=1S/C23H25ClN2O5/c1-23(2,3)18-10-13-9-17(31-8-6-7-30-5)16(24)11-14(13)20-19(25-4)21(27)15(22(28)29)12-26(18)20/h9,11-12,18H,6-8,10H2,1-3,5H3,(H,28,29) |
| InChIKey | JYVDDFXGBPFXAW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|