C33H32F4N2O2 — CID 140879854
5-tert-butyl-2',7'-bis(3,3-difluoroazetidin-1-yl)-9',9'-dimethylspiro[2-benzofuran-3,10'-anthracene]-1-one (PubChem CID 140879854) has the molecular formula C33H32F4N2O2 and a molecular weight of 564.62 g/mol. Its IUPAC name is 5-tert-butyl-2',7'-bis(3,3-difluoroazetidin-1-yl)-9',9'-dimethylspiro[2-benzofuran-3,10'-anthracene]-1-one.
| Compound Name | 5-tert-butyl-2',7'-bis(3,3-difluoroazetidin-1-yl)-9',9'-dimethylspiro[2-benzofuran-3,10'-anthracene]-1-one |
|---|---|
| PubChem CID | 140879854 |
| Molecular Formula | C33H32F4N2O2 |
| Molecular Weight | 564.62 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 5-tert-butyl-2',7'-bis(3,3-difluoroazetidin-1-yl)-9',9'-dimethylspiro[2-benzofuran-3,10'-anthracene]-1-one |
| SMILES | CC(C)(C)c1ccc2c(c1)C1(OC2=O)c2ccc(N3CC(F)(F)C3)cc2C(C)(C)c2cc(N3CC(F)(F)C3)ccc21 |
| InChI | InChI=1S/C33H32F4N2O2/c1-29(2,3)19-6-9-22-25(12-19)33(41-28(22)40)23-10-7-20(38-15-31(34,35)16-38)13-26(23)30(4,5)27-14-21(8-11-24(27)33)39-17-32(36,37)18-39/h6-14H,15-18H2,1-5H3 |
| InChIKey | IQOMKHGOKJIQQI-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.62 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|