C35H30N2Si — CID 140880032
(8,22-diphenyl-8,22-diazapentacyclo[13.7.0.02,7.09,14.016,21]docosa-1(15),2,4,6,9(14),10,12,16,18,20-decaen-12-yl)-trimethylsilane (PubChem CID 140880032) has the molecular formula C35H30N2Si and a molecular weight of 506.73 g/mol. Its IUPAC name is (8,22-diphenyl-8,22-diazapentacyclo[13.7.0.02,7.09,14.016,21]docosa-1(15),2,4,6,9(14),10,12,16,18,20-decaen-12-yl)-trimethylsilane.
| Compound Name | (8,22-diphenyl-8,22-diazapentacyclo[13.7.0.02,7.09,14.016,21]docosa-1(15),2,4,6,9(14),10,12,16,18,20-decaen-12-yl)-trimethylsilane |
|---|---|
| PubChem CID | 140880032 |
| Molecular Formula | C35H30N2Si |
| Molecular Weight | 506.73 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | (8,22-diphenyl-8,22-diazapentacyclo[13.7.0.02,7.09,14.016,21]docosa-1(15),2,4,6,9(14),10,12,16,18,20-decaen-12-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc2c(c1)-c1c(n(-c3ccccc3)c3ccccc13)-c1ccccc1N2c1ccccc1 |
| InChI | InChI=1S/C35H30N2Si/c1-38(2,3)27-22-23-33-30(24-27)34-28-18-10-12-20-31(28)37(26-16-8-5-9-17-26)35(34)29-19-11-13-21-32(29)36(33)25-14-6-4-7-15-25/h4-24H,1-3H3 |
| InChIKey | VHTLRVXEOWJPSB-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.73 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|