C17H27BN2O5S — CID 140880178
[(1R)-2-(2,4-dimethylphenyl)-1-[3-(1,1-dioxothiazinan-2-yl)propanoylamino]ethyl]boronic acid (PubChem CID 140880178) has the molecular formula C17H27BN2O5S and a molecular weight of 382.29 g/mol. Its IUPAC name is [(1R)-2-(2,4-dimethylphenyl)-1-[3-(1,1-dioxothiazinan-2-yl)propanoylamino]ethyl]boronic acid.
| Compound Name | [(1R)-2-(2,4-dimethylphenyl)-1-[3-(1,1-dioxothiazinan-2-yl)propanoylamino]ethyl]boronic acid |
|---|---|
| PubChem CID | 140880178 |
| Molecular Formula | C17H27BN2O5S |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | [(1R)-2-(2,4-dimethylphenyl)-1-[3-(1,1-dioxothiazinan-2-yl)propanoylamino]ethyl]boronic acid |
| SMILES | Cc1ccc(C[C@H](NC(=O)CCN2CCCCS2(=O)=O)B(O)O)c(C)c1 |
| InChI | InChI=1S/C17H27BN2O5S/c1-13-5-6-15(14(2)11-13)12-16(18(22)23)19-17(21)7-9-20-8-3-4-10-26(20,24)25/h5-6,11,16,22-23H,3-4,7-10,12H2,1-2H3,(H,19,21)/t16-/m0/s1 |
| InChIKey | KRCIEHZDILOPEU-INIZCTEOSA-N |
| XLogP | 0.16 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|