About [(1R)-1-[3-(2,2-dimethyl-5-oxopyrrolidin-1-yl)propanoylamino]-2-(4-methylphenyl)ethyl]boronic acid
[(1R)-1-[3-(2,2-dimethyl-5-oxopyrrolidin-1-yl)propanoylamino]-2-(4-methylphenyl)ethyl]boronic acid (PubChem CID 140880192) has the molecular formula C18H27BN2O4
and a molecular weight of 346.24 g/mol. Its IUPAC name is [(1R)-1-[3-(2,2-dimethyl-5-oxopyrrolidin-1-yl)propanoylamino]-2-(4-methylphenyl)ethyl]boronic acid.
Molecular Properties
| Compound Name | [(1R)-1-[3-(2,2-dimethyl-5-oxopyrrolidin-1-yl)propanoylamino]-2-(4-methylphenyl)ethyl]boronic acid |
| PubChem CID | 140880192 |
| Molecular Formula | C18H27BN2O4 |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | [(1R)-1-[3-(2,2-dimethyl-5-oxopyrrolidin-1-yl)propanoylamino]-2-(4-methylphenyl)ethyl]boronic acid |
| SMILES | Cc1ccc(C[C@H](NC(=O)CCN2C(=O)CCC2(C)C)B(O)O)cc1 |
| InChI | InChI=1S/C18H27BN2O4/c1-13-4-6-14(7-5-13)12-15(19(24)25)20-16(22)9-11-21-17(23)8-10-18(21,2)3/h4-7,15,24-25H,8-12H2,1-3H3,(H,20,22)/t15-/m0/s1 |
| InChIKey | PZRIECGVFHLXQJ-HNNXBMFYSA-N |
| XLogP | 0.83 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1-[3-(2,2-dimethyl-5-oxopyrrolidin-1-yl)propanoylamino]-2-(4-methylphenyl)ethyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-[3-(2,2-dimethyl-5-oxopyrrolidin-1-yl)propanoylamino]-2-(4-methylphenyl)ethyl]boronic acid?
The IUPAC name of [(1R)-1-[3-(2,2-dimethyl-5-oxopyrrolidin-1-yl)propanoylamino]-2-(4-methylphenyl)ethyl]boronic acid (CID 140880192) is [(1R)-1-[3-(2,2-dimethyl-5-oxopyrrolidin-1-yl)propanoylamino]-2-(4-methylphenyl)ethyl]boronic acid.
What is the SMILES notation for [(1R)-1-[3-(2,2-dimethyl-5-oxopyrrolidin-1-yl)propanoylamino]-2-(4-methylphenyl)ethyl]boronic acid?
The canonical SMILES for [(1R)-1-[3-(2,2-dimethyl-5-oxopyrrolidin-1-yl)propanoylamino]-2-(4-methylphenyl)ethyl]boronic acid is Cc1ccc(C[C@H](NC(=O)CCN2C(=O)CCC2(C)C)B(O)O)cc1.
What is the InChIKey of [(1R)-1-[3-(2,2-dimethyl-5-oxopyrrolidin-1-yl)propanoylamino]-2-(4-methylphenyl)ethyl]boronic acid?
The InChIKey is PZRIECGVFHLXQJ-HNNXBMFYSA-N. The full InChI is InChI=1S/C18H27BN2O4/c1-13-4-6-14(7-5-13)12-15(19(24)25)20-16(22)9-11-21-17(23)8-10-18(21,2)3/h4-7,15,24-25H,8-12H2,1-3H3,(H,20,22)/t15-/m0/s1.
What are the key properties of [(1R)-1-[3-(2,2-dimethyl-5-oxopyrrolidin-1-yl)propanoylamino]-2-(4-methylphenyl)ethyl]boronic acid?
[(1R)-1-[3-(2,2-dimethyl-5-oxopyrrolidin-1-yl)propanoylamino]-2-(4-methylphenyl)ethyl]boronic acid has a molecular weight of 346.24 g/mol, XLogP of 0.83, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-[3-(2,2-dimethyl-5-oxopyrrolidin-1-yl)propanoylamino]-2-(4-methylphenyl)ethyl]boronic acid is sourced from PubChem (CID 140880192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).