C31H31F4N7O2 — CID 140880421
5-[2-[4-[4-(5-isocyano-1H-indol-3-yl)butyl]piperazin-1-yl]pyrimidin-5-yl]-2-(2,2,3,3-tetrafluoropropoxy)benzamide (PubChem CID 140880421) has the molecular formula C31H31F4N7O2 and a molecular weight of 609.63 g/mol. Its IUPAC name is 5-[2-[4-[4-(5-isocyano-1H-indol-3-yl)butyl]piperazin-1-yl]pyrimidin-5-yl]-2-(2,2,3,3-tetrafluoropropoxy)benzamide.
| Compound Name | 5-[2-[4-[4-(5-isocyano-1H-indol-3-yl)butyl]piperazin-1-yl]pyrimidin-5-yl]-2-(2,2,3,3-tetrafluoropropoxy)benzamide |
|---|---|
| PubChem CID | 140880421 |
| Molecular Formula | C31H31F4N7O2 |
| Molecular Weight | 609.63 g/mol |
| Exact Mass | 609.25 |
| IUPAC Name | 5-[2-[4-[4-(5-isocyano-1H-indol-3-yl)butyl]piperazin-1-yl]pyrimidin-5-yl]-2-(2,2,3,3-tetrafluoropropoxy)benzamide |
| SMILES | [C-]#[N+]c1ccc2[nH]cc(CCCCN3CCN(c4ncc(-c5ccc(OCC(F)(F)C(F)F)c(C(N)=O)c5)cn4)CC3)c2c1 |
| InChI | InChI=1S/C31H31F4N7O2/c1-37-23-6-7-26-24(15-23)21(16-38-26)4-2-3-9-41-10-12-42(13-11-41)30-39-17-22(18-40-30)20-5-8-27(25(14-20)28(36)43)44-19-31(34,35)29(32)33/h5-8,14-18,29,38H,2-4,9-13,19H2,(H2,36,43) |
| InChIKey | ZFWXCLSHGADSRC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.63 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|