C30H29F4N7O2 — CID 140880434
4-[2-[4-[3-(5-isocyano-1H-indol-3-yl)propyl]piperazin-1-yl]pyrimidin-5-yl]-2-(2,2,3,3-tetrafluoropropoxy)benzamide (PubChem CID 140880434) has the molecular formula C30H29F4N7O2 and a molecular weight of 595.60 g/mol. Its IUPAC name is 4-[2-[4-[3-(5-isocyano-1H-indol-3-yl)propyl]piperazin-1-yl]pyrimidin-5-yl]-2-(2,2,3,3-tetrafluoropropoxy)benzamide.
| Compound Name | 4-[2-[4-[3-(5-isocyano-1H-indol-3-yl)propyl]piperazin-1-yl]pyrimidin-5-yl]-2-(2,2,3,3-tetrafluoropropoxy)benzamide |
|---|---|
| PubChem CID | 140880434 |
| Molecular Formula | C30H29F4N7O2 |
| Molecular Weight | 595.60 g/mol |
| Exact Mass | 595.23 |
| IUPAC Name | 4-[2-[4-[3-(5-isocyano-1H-indol-3-yl)propyl]piperazin-1-yl]pyrimidin-5-yl]-2-(2,2,3,3-tetrafluoropropoxy)benzamide |
| SMILES | [C-]#[N+]c1ccc2[nH]cc(CCCN3CCN(c4ncc(-c5ccc(C(N)=O)c(OCC(F)(F)C(F)F)c5)cn4)CC3)c2c1 |
| InChI | InChI=1S/C30H29F4N7O2/c1-36-22-5-7-25-24(14-22)20(15-37-25)3-2-8-40-9-11-41(12-10-40)29-38-16-21(17-39-29)19-4-6-23(27(35)42)26(13-19)43-18-30(33,34)28(31)32/h4-7,13-17,28,37H,2-3,8-12,18H2,(H2,35,42) |
| InChIKey | RQCBFOCTZKRHNC-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.60 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|