About 2-(1,3,2-dioxaborolan-2-yl)-N,N-dimethylaniline
2-(1,3,2-dioxaborolan-2-yl)-N,N-dimethylaniline (PubChem CID 140881676) has the molecular formula C10H14BNO2
and a molecular weight of 191.04 g/mol. Its IUPAC name is 2-(1,3,2-dioxaborolan-2-yl)-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 2-(1,3,2-dioxaborolan-2-yl)-N,N-dimethylaniline |
| PubChem CID | 140881676 |
| Molecular Formula | C10H14BNO2 |
| Molecular Weight | 191.04 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-(1,3,2-dioxaborolan-2-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccccc1B1OCCO1 |
| InChI | InChI=1S/C10H14BNO2/c1-12(2)10-6-4-3-5-9(10)11-13-7-8-14-11/h3-6H,7-8H2,1-2H3 |
| InChIKey | NVGLNPSAZOYPNW-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.04 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3,2-dioxaborolan-2-yl)-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3,2-dioxaborolan-2-yl)-N,N-dimethylaniline?
The IUPAC name of 2-(1,3,2-dioxaborolan-2-yl)-N,N-dimethylaniline (CID 140881676) is 2-(1,3,2-dioxaborolan-2-yl)-N,N-dimethylaniline.
What is the SMILES notation for 2-(1,3,2-dioxaborolan-2-yl)-N,N-dimethylaniline?
The canonical SMILES for 2-(1,3,2-dioxaborolan-2-yl)-N,N-dimethylaniline is CN(C)c1ccccc1B1OCCO1.
What is the InChIKey of 2-(1,3,2-dioxaborolan-2-yl)-N,N-dimethylaniline?
The InChIKey is NVGLNPSAZOYPNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BNO2/c1-12(2)10-6-4-3-5-9(10)11-13-7-8-14-11/h3-6H,7-8H2,1-2H3.
What are the key properties of 2-(1,3,2-dioxaborolan-2-yl)-N,N-dimethylaniline?
2-(1,3,2-dioxaborolan-2-yl)-N,N-dimethylaniline has a molecular weight of 191.04 g/mol, XLogP of 0.49, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3,2-dioxaborolan-2-yl)-N,N-dimethylaniline is sourced from PubChem (CID 140881676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).