C20H31Cl2N5O — CID 140882596
(2S)-4-[7-chloro-6-(4-chlorocyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]-1-formylpiperazine-2-carbonitrile (PubChem CID 140882596) has the molecular formula C20H31Cl2N5O and a molecular weight of 428.41 g/mol. Its IUPAC name is (2S)-4-[7-chloro-6-(4-chlorocyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]-1-formylpiperazine-2-carbonitrile.
| Compound Name | (2S)-4-[7-chloro-6-(4-chlorocyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]-1-formylpiperazine-2-carbonitrile |
|---|---|
| PubChem CID | 140882596 |
| Molecular Formula | C20H31Cl2N5O |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | (2S)-4-[7-chloro-6-(4-chlorocyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]-1-formylpiperazine-2-carbonitrile |
| SMILES | N#C[C@@H]1CN(C2NCNC3CC(Cl)C(C4CCC(Cl)CC4)CC32)CCN1C=O |
| InChI | InChI=1S/C20H31Cl2N5O/c21-14-3-1-13(2-4-14)16-7-17-19(8-18(16)22)24-11-25-20(17)26-5-6-27(12-28)15(9-23)10-26/h12-20,24-25H,1-8,10-11H2/t13?,14?,15-,16?,17?,18?,19?,20?/m1/s1 |
| InChIKey | IUXGOZMNXIMYSI-BBTFNWHDSA-N |
| XLogP | 1.93 |
| TPSA | 71.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|