C23H40ClFN6O2 — CID 140882601
4-[6-chloro-8-fluoro-7-(3-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]-N'-hydroxypiperazine-1-carboximidamide (PubChem CID 140882601) has the molecular formula C23H40ClFN6O2 and a molecular weight of 487.06 g/mol. Its IUPAC name is 4-[6-chloro-8-fluoro-7-(3-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]-N'-hydroxypiperazine-1-carboximidamide.
| Compound Name | 4-[6-chloro-8-fluoro-7-(3-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]-N'-hydroxypiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 140882601 |
| Molecular Formula | C23H40ClFN6O2 |
| Molecular Weight | 487.06 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | 4-[6-chloro-8-fluoro-7-(3-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]-N'-hydroxypiperazine-1-carboximidamide |
| SMILES | N/C(=N\O)N1CCN(C2NCNC3C(F)C(C4CC(O)CC5CCCCC54)C(Cl)CC32)CC1 |
| InChI | InChI=1S/C23H40ClFN6O2/c24-18-11-17-21(27-12-28-22(17)30-5-7-31(8-6-30)23(26)29-33)20(25)19(18)16-10-14(32)9-13-3-1-2-4-15(13)16/h13-22,27-28,32-33H,1-12H2,(H2,26,29) |
| InChIKey | JLFMNFXMEGXJSS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.06 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|