C23H40ClFN4O — CID 140882604
4-[4-(3-aminopiperidin-1-yl)-6-chloro-8-fluoro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-7-yl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol (PubChem CID 140882604) has the molecular formula C23H40ClFN4O and a molecular weight of 443.05 g/mol. Its IUPAC name is 4-[4-(3-aminopiperidin-1-yl)-6-chloro-8-fluoro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-7-yl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol.
| Compound Name | 4-[4-(3-aminopiperidin-1-yl)-6-chloro-8-fluoro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-7-yl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 140882604 |
| Molecular Formula | C23H40ClFN4O |
| Molecular Weight | 443.05 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | 4-[4-(3-aminopiperidin-1-yl)-6-chloro-8-fluoro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-7-yl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol |
| SMILES | NC1CCCN(C2NCNC3C(F)C(C4CC(O)CC5CCCCC54)C(Cl)CC32)C1 |
| InChI | InChI=1S/C23H40ClFN4O/c24-19-10-18-22(27-12-28-23(18)29-7-3-5-14(26)11-29)21(25)20(19)17-9-15(30)8-13-4-1-2-6-16(13)17/h13-23,27-28,30H,1-12,26H2 |
| InChIKey | LEVYUYYFWSPMDQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 73.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.05 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|