C25H42ClFN4O2 — CID 140882610
1-[4-[6-chloro-8-fluoro-7-(3-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]piperazin-1-yl]propan-1-one (PubChem CID 140882610) has the molecular formula C25H42ClFN4O2 and a molecular weight of 485.09 g/mol. Its IUPAC name is 1-[4-[6-chloro-8-fluoro-7-(3-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]piperazin-1-yl]propan-1-one.
| Compound Name | 1-[4-[6-chloro-8-fluoro-7-(3-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 140882610 |
| Molecular Formula | C25H42ClFN4O2 |
| Molecular Weight | 485.09 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | 1-[4-[6-chloro-8-fluoro-7-(3-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]piperazin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCN(C2NCNC3C(F)C(C4CC(O)CC5CCCCC54)C(Cl)CC32)CC1 |
| InChI | InChI=1S/C25H42ClFN4O2/c1-2-21(33)30-7-9-31(10-8-30)25-19-13-20(26)22(23(27)24(19)28-14-29-25)18-12-16(32)11-15-5-3-4-6-17(15)18/h15-20,22-25,28-29,32H,2-14H2,1H3 |
| InChIKey | DGCHIDNPFKWOTR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.09 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|