C25H41ClFN5O4 — CID 140882624
3-[4-[6-chloro-8-fluoro-7-(3-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]piperazin-1-yl]-N-hydroxy-3-oxopropanamide (PubChem CID 140882624) has the molecular formula C25H41ClFN5O4 and a molecular weight of 530.09 g/mol. Its IUPAC name is 3-[4-[6-chloro-8-fluoro-7-(3-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]piperazin-1-yl]-N-hydroxy-3-oxopropanamide.
| Compound Name | 3-[4-[6-chloro-8-fluoro-7-(3-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]piperazin-1-yl]-N-hydroxy-3-oxopropanamide |
|---|---|
| PubChem CID | 140882624 |
| Molecular Formula | C25H41ClFN5O4 |
| Molecular Weight | 530.09 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | 3-[4-[6-chloro-8-fluoro-7-(3-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]piperazin-1-yl]-N-hydroxy-3-oxopropanamide |
| SMILES | O=C(CC(=O)N1CCN(C2NCNC3C(F)C(C4CC(O)CC5CCCCC54)C(Cl)CC32)CC1)NO |
| InChI | InChI=1S/C25H41ClFN5O4/c26-19-11-18-24(23(27)22(19)17-10-15(33)9-14-3-1-2-4-16(14)17)28-13-29-25(18)32-7-5-31(6-8-32)21(35)12-20(34)30-36/h14-19,22-25,28-29,33,36H,1-13H2,(H,30,34) |
| InChIKey | LBUUUABOTCJGJH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.09 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|