C22H36Cl2N6O — CID 140882628
1-(3-aminopropanoyl)-4-[7-chloro-6-(4-chlorocyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]piperazine-2-carbonitrile (PubChem CID 140882628) has the molecular formula C22H36Cl2N6O and a molecular weight of 471.48 g/mol. Its IUPAC name is 1-(3-aminopropanoyl)-4-[7-chloro-6-(4-chlorocyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]piperazine-2-carbonitrile.
| Compound Name | 1-(3-aminopropanoyl)-4-[7-chloro-6-(4-chlorocyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]piperazine-2-carbonitrile |
|---|---|
| PubChem CID | 140882628 |
| Molecular Formula | C22H36Cl2N6O |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 1-(3-aminopropanoyl)-4-[7-chloro-6-(4-chlorocyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]piperazine-2-carbonitrile |
| SMILES | N#CC1CN(C2NCNC3CC(Cl)C(C4CCC(Cl)CC4)CC32)CCN1C(=O)CCN |
| InChI | InChI=1S/C22H36Cl2N6O/c23-15-3-1-14(2-4-15)17-9-18-20(10-19(17)24)27-13-28-22(18)29-7-8-30(16(11-26)12-29)21(31)5-6-25/h14-20,22,27-28H,1-10,12-13,25H2 |
| InChIKey | DTDXMJKYTIKZIR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|