C24H42ClFN4O2 — CID 140882631
4-[6-chloro-8-fluoro-4-[4-(2-hydroxyethyl)piperazin-1-yl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-7-yl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol (PubChem CID 140882631) has the molecular formula C24H42ClFN4O2 and a molecular weight of 473.08 g/mol. Its IUPAC name is 4-[6-chloro-8-fluoro-4-[4-(2-hydroxyethyl)piperazin-1-yl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-7-yl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol.
| Compound Name | 4-[6-chloro-8-fluoro-4-[4-(2-hydroxyethyl)piperazin-1-yl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-7-yl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 140882631 |
| Molecular Formula | C24H42ClFN4O2 |
| Molecular Weight | 473.08 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | 4-[6-chloro-8-fluoro-4-[4-(2-hydroxyethyl)piperazin-1-yl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-7-yl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol |
| SMILES | OCCN1CCN(C2NCNC3C(F)C(C4CC(O)CC5CCCCC54)C(Cl)CC32)CC1 |
| InChI | InChI=1S/C24H42ClFN4O2/c25-20-13-19-23(27-14-28-24(19)30-7-5-29(6-8-30)9-10-31)22(26)21(20)18-12-16(32)11-15-3-1-2-4-17(15)18/h15-24,27-28,31-32H,1-14H2 |
| InChIKey | QHTUIXHMFIVSAB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.08 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|