C21H35ClF2N4O2 — CID 140882633
1-[4-[6-chloro-8-fluoro-7-(2-fluoro-6-hydroxycyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]piperazin-1-yl]propan-1-one (PubChem CID 140882633) has the molecular formula C21H35ClF2N4O2 and a molecular weight of 448.99 g/mol. Its IUPAC name is 1-[4-[6-chloro-8-fluoro-7-(2-fluoro-6-hydroxycyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]piperazin-1-yl]propan-1-one.
| Compound Name | 1-[4-[6-chloro-8-fluoro-7-(2-fluoro-6-hydroxycyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 140882633 |
| Molecular Formula | C21H35ClF2N4O2 |
| Molecular Weight | 448.99 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 1-[4-[6-chloro-8-fluoro-7-(2-fluoro-6-hydroxycyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]piperazin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCN(C2NCNC3C(F)C(C4C(O)CCCC4F)C(Cl)CC32)CC1 |
| InChI | InChI=1S/C21H35ClF2N4O2/c1-2-16(30)27-6-8-28(9-7-27)21-12-10-13(22)17(19(24)20(12)25-11-26-21)18-14(23)4-3-5-15(18)29/h12-15,17-21,25-26,29H,2-11H2,1H3 |
| InChIKey | WEDODWUTRYZLQY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.99 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|