C27H44ClFN4O3 — CID 140882634
[4-[6-chloro-8-fluoro-7-(3-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]piperazin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 140882634) has the molecular formula C27H44ClFN4O3 and a molecular weight of 527.13 g/mol. Its IUPAC name is [4-[6-chloro-8-fluoro-7-(3-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]piperazin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [4-[6-chloro-8-fluoro-7-(3-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]piperazin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 140882634 |
| Molecular Formula | C27H44ClFN4O3 |
| Molecular Weight | 527.13 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | [4-[6-chloro-8-fluoro-7-(3-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]piperazin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | O=C(C1CCCO1)N1CCN(C2NCNC3C(F)C(C4CC(O)CC5CCCCC54)C(Cl)CC32)CC1 |
| InChI | InChI=1S/C27H44ClFN4O3/c28-21-14-20-25(24(29)23(21)19-13-17(34)12-16-4-1-2-5-18(16)19)30-15-31-26(20)32-7-9-33(10-8-32)27(35)22-6-3-11-36-22/h16-26,30-31,34H,1-15H2 |
| InChIKey | YRZSVBYYYJJYSV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.13 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|