C23H39NO5Si2 — CID 140883343
2-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-yloxy]isoindole-1,3-dione (PubChem CID 140883343) has the molecular formula C23H39NO5Si2 and a molecular weight of 465.74 g/mol. Its IUPAC name is 2-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-yloxy]isoindole-1,3-dione.
| Compound Name | 2-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-yloxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 140883343 |
| Molecular Formula | C23H39NO5Si2 |
| Molecular Weight | 465.74 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 2-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-yloxy]isoindole-1,3-dione |
| SMILES | CC(C)(C)[Si](C)(C)OCC(CO[Si](C)(C)C(C)(C)C)ON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H39NO5Si2/c1-22(2,3)30(7,8)27-15-17(16-28-31(9,10)23(4,5)6)29-24-20(25)18-13-11-12-14-19(18)21(24)26/h11-14,17H,15-16H2,1-10H3 |
| InChIKey | NGPOGIOUOIDQKM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.74 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|