About 1-cyclopropyl-2-[4-(1,1-difluoroethyl)pyrimidin-5-yl]-6-isocyanobenzimidazole
1-cyclopropyl-2-[4-(1,1-difluoroethyl)pyrimidin-5-yl]-6-isocyanobenzimidazole (PubChem CID 140883877) has the molecular formula C17H13F2N5
and a molecular weight of 325.32 g/mol. Its IUPAC name is 1-cyclopropyl-2-[4-(1,1-difluoroethyl)pyrimidin-5-yl]-6-isocyanobenzimidazole.
Molecular Properties
| Compound Name | 1-cyclopropyl-2-[4-(1,1-difluoroethyl)pyrimidin-5-yl]-6-isocyanobenzimidazole |
| PubChem CID | 140883877 |
| Molecular Formula | C17H13F2N5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 1-cyclopropyl-2-[4-(1,1-difluoroethyl)pyrimidin-5-yl]-6-isocyanobenzimidazole |
| SMILES | [C-]#[N+]c1ccc2nc(-c3cncnc3C(C)(F)F)n(C3CC3)c2c1 |
| InChI | InChI=1S/C17H13F2N5/c1-17(18,19)15-12(8-21-9-22-15)16-23-13-6-3-10(20-2)7-14(13)24(16)11-4-5-11/h3,6-9,11H,4-5H2,1H3 |
| InChIKey | QSNGFDVKGKSBFV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 47.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopropyl-2-[4-(1,1-difluoroethyl)pyrimidin-5-yl]-6-isocyanobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-2-[4-(1,1-difluoroethyl)pyrimidin-5-yl]-6-isocyanobenzimidazole?
The IUPAC name of 1-cyclopropyl-2-[4-(1,1-difluoroethyl)pyrimidin-5-yl]-6-isocyanobenzimidazole (CID 140883877) is 1-cyclopropyl-2-[4-(1,1-difluoroethyl)pyrimidin-5-yl]-6-isocyanobenzimidazole.
What is the SMILES notation for 1-cyclopropyl-2-[4-(1,1-difluoroethyl)pyrimidin-5-yl]-6-isocyanobenzimidazole?
The canonical SMILES for 1-cyclopropyl-2-[4-(1,1-difluoroethyl)pyrimidin-5-yl]-6-isocyanobenzimidazole is [C-]#[N+]c1ccc2nc(-c3cncnc3C(C)(F)F)n(C3CC3)c2c1.
What is the InChIKey of 1-cyclopropyl-2-[4-(1,1-difluoroethyl)pyrimidin-5-yl]-6-isocyanobenzimidazole?
The InChIKey is QSNGFDVKGKSBFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F2N5/c1-17(18,19)15-12(8-21-9-22-15)16-23-13-6-3-10(20-2)7-14(13)24(16)11-4-5-11/h3,6-9,11H,4-5H2,1H3.
What are the key properties of 1-cyclopropyl-2-[4-(1,1-difluoroethyl)pyrimidin-5-yl]-6-isocyanobenzimidazole?
1-cyclopropyl-2-[4-(1,1-difluoroethyl)pyrimidin-5-yl]-6-isocyanobenzimidazole has a molecular weight of 325.32 g/mol, XLogP of 4.49, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-2-[4-(1,1-difluoroethyl)pyrimidin-5-yl]-6-isocyanobenzimidazole is sourced from PubChem (CID 140883877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).