C15H19Cl — CID 140883960
(1R,4S)-1-(2-chlorophenyl)-4-propan-2-ylbicyclo[3.1.0]hexane (PubChem CID 140883960) has the molecular formula C15H19Cl and a molecular weight of 234.77 g/mol. Its IUPAC name is (1R,4S)-1-(2-chlorophenyl)-4-propan-2-ylbicyclo[3.1.0]hexane.
| Compound Name | (1R,4S)-1-(2-chlorophenyl)-4-propan-2-ylbicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 140883960 |
| Molecular Formula | C15H19Cl |
| Molecular Weight | 234.77 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | (1R,4S)-1-(2-chlorophenyl)-4-propan-2-ylbicyclo[3.1.0]hexane |
| SMILES | CC(C)[C@@H]1CC[C@@]2(c3ccccc3Cl)CC12 |
| InChI | InChI=1S/C15H19Cl/c1-10(2)11-7-8-15(9-13(11)15)12-5-3-4-6-14(12)16/h3-6,10-11,13H,7-9H2,1-2H3/t11-,13?,15-/m0/s1 |
| InChIKey | YRAICNHCIOFMEI-BJLZJLDMSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.77 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |