About 13-(benzenesulfonyl)-9,11-bis(triethylsilyloxy)tridec-6-en-5-ol
13-(benzenesulfonyl)-9,11-bis(triethylsilyloxy)tridec-6-en-5-ol (PubChem CID 140883999) has the molecular formula C31H58O5SSi2
and a molecular weight of 599.04 g/mol. Its IUPAC name is 13-(benzenesulfonyl)-9,11-bis(triethylsilyloxy)tridec-6-en-5-ol.
Molecular Properties
| Compound Name | 13-(benzenesulfonyl)-9,11-bis(triethylsilyloxy)tridec-6-en-5-ol |
| PubChem CID | 140883999 |
| Molecular Formula | C31H58O5SSi2 |
| Molecular Weight | 599.04 g/mol |
| Exact Mass | 598.35 |
| IUPAC Name | 13-(benzenesulfonyl)-9,11-bis(triethylsilyloxy)tridec-6-en-5-ol |
| SMILES | CCCCC(O)C=CCC(CC(CCS(=O)(=O)c1ccccc1)O[Si](CC)(CC)CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C31H58O5SSi2/c1-8-15-20-28(32)21-19-22-29(35-38(9-2,10-3)11-4)27-30(36-39(12-5,13-6)14-7)25-26-37(33,34)31-23-17-16-18-24-31/h16-19,21,23-24,28-30,32H,8-15,20,22,25-27H2,1-7H3 |
| InChIKey | MKUPDANEMHNRFY-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 599.04 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 13-(benzenesulfonyl)-9,11-bis(triethylsilyloxy)tridec-6-en-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 13-(benzenesulfonyl)-9,11-bis(triethylsilyloxy)tridec-6-en-5-ol?
The IUPAC name of 13-(benzenesulfonyl)-9,11-bis(triethylsilyloxy)tridec-6-en-5-ol (CID 140883999) is 13-(benzenesulfonyl)-9,11-bis(triethylsilyloxy)tridec-6-en-5-ol.
What is the SMILES notation for 13-(benzenesulfonyl)-9,11-bis(triethylsilyloxy)tridec-6-en-5-ol?
The canonical SMILES for 13-(benzenesulfonyl)-9,11-bis(triethylsilyloxy)tridec-6-en-5-ol is CCCCC(O)C=CCC(CC(CCS(=O)(=O)c1ccccc1)O[Si](CC)(CC)CC)O[Si](CC)(CC)CC.
What is the InChIKey of 13-(benzenesulfonyl)-9,11-bis(triethylsilyloxy)tridec-6-en-5-ol?
The InChIKey is MKUPDANEMHNRFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H58O5SSi2/c1-8-15-20-28(32)21-19-22-29(35-38(9-2,10-3)11-4)27-30(36-39(12-5,13-6)14-7)25-26-37(33,34)31-23-17-16-18-24-31/h16-19,21,23-24,28-30,32H,8-15,20,22,25-27H2,1-7H3.
What are the key properties of 13-(benzenesulfonyl)-9,11-bis(triethylsilyloxy)tridec-6-en-5-ol?
13-(benzenesulfonyl)-9,11-bis(triethylsilyloxy)tridec-6-en-5-ol has a molecular weight of 599.04 g/mol, XLogP of 8.52, 22 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 13-(benzenesulfonyl)-9,11-bis(triethylsilyloxy)tridec-6-en-5-ol is sourced from PubChem (CID 140883999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).