About CID 140884144
CID 140884144 (PubChem CID 140884144) has the molecular formula C15H15N3
and a molecular weight of 237.31 g/mol.
Molecular Properties
| Compound Name | CID 140884144 |
| PubChem CID | 140884144 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | — |
| SMILES | [CH2][C]1N(C)c2ncccc2N1c1ccccc1C |
| InChI | InChI=1S/C15H15N3/c1-11-7-4-5-8-13(11)18-12(2)17(3)15-14(18)9-6-10-16-15/h4-10H,2H2,1,3H3 |
| InChIKey | QSQZIAIYEBMCOB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 140884144 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140884144?
The IUPAC name of CID 140884144 (CID 140884144) is not available.
What is the SMILES notation for CID 140884144?
The canonical SMILES for CID 140884144 is [CH2][C]1N(C)c2ncccc2N1c1ccccc1C.
What is the InChIKey of CID 140884144?
The InChIKey is QSQZIAIYEBMCOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3/c1-11-7-4-5-8-13(11)18-12(2)17(3)15-14(18)9-6-10-16-15/h4-10H,2H2,1,3H3.
What are the key properties of CID 140884144?
CID 140884144 has a molecular weight of 237.31 g/mol, XLogP of 3.30, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140884144 is sourced from PubChem (CID 140884144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).