C16H23N3O7 — CID 140884249
(3R)-3-(2,4-dioxo-1H-pyrimidine-6-carbonyl)oxy-4-oxo-3-[(trimethylazaniumyl)methyl]heptanoate (PubChem CID 140884249) has the molecular formula C16H23N3O7 and a molecular weight of 369.37 g/mol. Its IUPAC name is (3R)-3-(2,4-dioxo-1H-pyrimidine-6-carbonyl)oxy-4-oxo-3-[(trimethylazaniumyl)methyl]heptanoate.
| Compound Name | (3R)-3-(2,4-dioxo-1H-pyrimidine-6-carbonyl)oxy-4-oxo-3-[(trimethylazaniumyl)methyl]heptanoate |
|---|---|
| PubChem CID | 140884249 |
| Molecular Formula | C16H23N3O7 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (3R)-3-(2,4-dioxo-1H-pyrimidine-6-carbonyl)oxy-4-oxo-3-[(trimethylazaniumyl)methyl]heptanoate |
| SMILES | CCCC(=O)[C@@](CC(=O)[O-])(C[N+](C)(C)C)OC(=O)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C16H23N3O7/c1-5-6-11(20)16(8-13(22)23,9-19(2,3)4)26-14(24)10-7-12(21)18-15(25)17-10/h7H,5-6,8-9H2,1-4H3,(H2-,17,18,21,22,23,25)/t16-/m1/s1 |
| InChIKey | URZOOVCJRAXZGX-MRXNPFEDSA-N |
| XLogP | -1.83 |
| TPSA | 149.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|