C17H31N5O5S — CID 140884660
1-(2-methoxyethyl)-N-(1-methylcyclopropyl)-3-(5-methyl-1,3,4-oxadiazolidin-2-yl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide (PubChem CID 140884660) has the molecular formula C17H31N5O5S and a molecular weight of 417.53 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-N-(1-methylcyclopropyl)-3-(5-methyl-1,3,4-oxadiazolidin-2-yl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide.
| Compound Name | 1-(2-methoxyethyl)-N-(1-methylcyclopropyl)-3-(5-methyl-1,3,4-oxadiazolidin-2-yl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 140884660 |
| Molecular Formula | C17H31N5O5S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 1-(2-methoxyethyl)-N-(1-methylcyclopropyl)-3-(5-methyl-1,3,4-oxadiazolidin-2-yl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide |
| SMILES | COCCN1C(=O)N(C2NNC(C)O2)C2CC(S(=O)(=O)NC3(C)CC3)CCC21 |
| InChI | InChI=1S/C17H31N5O5S/c1-11-18-19-15(27-11)22-14-10-12(28(24,25)20-17(2)6-7-17)4-5-13(14)21(16(22)23)8-9-26-3/h11-15,18-20H,4-10H2,1-3H3 |
| InChIKey | XNBNBZKBHRCXBU-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |