C16H25FN6O3S2 — CID 140884662
1-(cyanomethyl)-N-[1-(fluoromethyl)cyclopropyl]-3-(5-methyl-1,3,4-thiadiazolidin-2-yl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide (PubChem CID 140884662) has the molecular formula C16H25FN6O3S2 and a molecular weight of 432.55 g/mol. Its IUPAC name is 1-(cyanomethyl)-N-[1-(fluoromethyl)cyclopropyl]-3-(5-methyl-1,3,4-thiadiazolidin-2-yl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide.
| Compound Name | 1-(cyanomethyl)-N-[1-(fluoromethyl)cyclopropyl]-3-(5-methyl-1,3,4-thiadiazolidin-2-yl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 140884662 |
| Molecular Formula | C16H25FN6O3S2 |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 1-(cyanomethyl)-N-[1-(fluoromethyl)cyclopropyl]-3-(5-methyl-1,3,4-thiadiazolidin-2-yl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide |
| SMILES | CC1NNC(N2C(=O)N(CC#N)C3CCC(S(=O)(=O)NC4(CF)CC4)CC32)S1 |
| InChI | InChI=1S/C16H25FN6O3S2/c1-10-19-20-14(27-10)23-13-8-11(28(25,26)21-16(9-17)4-5-16)2-3-12(13)22(7-6-18)15(23)24/h10-14,19-21H,2-5,7-9H2,1H3 |
| InChIKey | OLJLTEUJGKDVJV-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 117.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|