C20H35N5O3S3 — CID 140884677
1-[(2,4-dimethyl-1,3-thiazolidin-5-yl)methyl]-N-(1-methylcyclopropyl)-2-oxo-3-(1,2-thiazolidin-4-yl)-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide (PubChem CID 140884677) has the molecular formula C20H35N5O3S3 and a molecular weight of 489.73 g/mol. Its IUPAC name is 1-[(2,4-dimethyl-1,3-thiazolidin-5-yl)methyl]-N-(1-methylcyclopropyl)-2-oxo-3-(1,2-thiazolidin-4-yl)-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide.
| Compound Name | 1-[(2,4-dimethyl-1,3-thiazolidin-5-yl)methyl]-N-(1-methylcyclopropyl)-2-oxo-3-(1,2-thiazolidin-4-yl)-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 140884677 |
| Molecular Formula | C20H35N5O3S3 |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 1-[(2,4-dimethyl-1,3-thiazolidin-5-yl)methyl]-N-(1-methylcyclopropyl)-2-oxo-3-(1,2-thiazolidin-4-yl)-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide |
| SMILES | CC1NC(C)C(CN2C(=O)N(C3CNSC3)C3CC(S(=O)(=O)NC4(C)CC4)CCC32)S1 |
| InChI | InChI=1S/C20H35N5O3S3/c1-12-18(30-13(2)22-12)10-24-16-5-4-15(31(27,28)23-20(3)6-7-20)8-17(16)25(19(24)26)14-9-21-29-11-14/h12-18,21-23H,4-11H2,1-3H3 |
| InChIKey | SBHLBNRHAZQSGS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|